C14H20Br2N2O — CID 65319036
2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(4,5-dibromofuran-2-yl)ethanamine (PubChem CID 65319036) has the molecular formula C14H20Br2N2O and a molecular weight of 392.14 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(4,5-dibromofuran-2-yl)ethanamine.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(4,5-dibromofuran-2-yl)ethanamine |
|---|---|
| PubChem CID | 65319036 |
| Molecular Formula | C14H20Br2N2O |
| Molecular Weight | 392.14 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(4,5-dibromofuran-2-yl)ethanamine |
| SMILES | NCC(c1cc(Br)c(Br)o1)N1CCCC2CCCC21 |
| InChI | InChI=1S/C14H20Br2N2O/c15-10-7-13(19-14(10)16)12(8-17)18-6-2-4-9-3-1-5-11(9)18/h7,9,11-12H,1-6,8,17H2 |
| InChIKey | ODCBFPDWGWGZHV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.14 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |