C15H23BrN2O — CID 106885610
2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(3-bromofuran-2-yl)ethanamine (PubChem CID 106885610) has the molecular formula C15H23BrN2O and a molecular weight of 327.27 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(3-bromofuran-2-yl)ethanamine.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(3-bromofuran-2-yl)ethanamine |
|---|---|
| PubChem CID | 106885610 |
| Molecular Formula | C15H23BrN2O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(3-bromofuran-2-yl)ethanamine |
| SMILES | NCC(c1occc1Br)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C15H23BrN2O/c16-12-7-9-19-15(12)14(10-17)18-8-3-5-11-4-1-2-6-13(11)18/h7,9,11,13-14H,1-6,8,10,17H2 |
| InChIKey | FZGYYFMRUNWDEG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |