C14H12O2S — CID 62199397
1-(2,3-dihydro-1-benzofuran-5-yl)-2-thiophen-3-ylethanone (PubChem CID 62199397) has the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-2-thiophen-3-ylethanone.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 62199397 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H12O2S/c15-13(7-10-4-6-17-9-10)11-1-2-14-12(8-11)3-5-16-14/h1-2,4,6,8-9H,3,5,7H2 |
| InChIKey | SPRQSJJUKAAZID-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |