C14H12N4O2 — CID 62208158
2-[(2-aminoquinolin-3-yl)methyl]-1H-pyridazine-3,6-dione (PubChem CID 62208158) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 2-[(2-aminoquinolin-3-yl)methyl]-1H-pyridazine-3,6-dione.
| Compound Name | 2-[(2-aminoquinolin-3-yl)methyl]-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 62208158 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-[(2-aminoquinolin-3-yl)methyl]-1H-pyridazine-3,6-dione |
| SMILES | Nc1nc2ccccc2cc1Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C14H12N4O2/c15-14-10(7-9-3-1-2-4-11(9)16-14)8-18-13(20)6-5-12(19)17-18/h1-7H,8H2,(H2,15,16)(H,17,19) |
| InChIKey | WJNZDCOEGOEBGT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |