C13H25N3O — CID 62210868
1-(1,4-diazepan-1-yl)-3-piperidin-2-ylpropan-1-one (PubChem CID 62210868) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-3-piperidin-2-ylpropan-1-one.
| Compound Name | 1-(1,4-diazepan-1-yl)-3-piperidin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 62210868 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-3-piperidin-2-ylpropan-1-one |
| SMILES | O=C(CCC1CCCCN1)N1CCCNCC1 |
| InChI | InChI=1S/C13H25N3O/c17-13(16-10-3-7-14-9-11-16)6-5-12-4-1-2-8-15-12/h12,14-15H,1-11H2 |
| InChIKey | NGZQBFARBYBCFI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |