C12H23ClN2O — CID 50988752
2-cyclopentyl-1-(1,4-diazepan-1-yl)ethanone;hydrochloride (PubChem CID 50988752) has the molecular formula C12H23ClN2O and a molecular weight of 246.78 g/mol. Its IUPAC name is 2-cyclopentyl-1-(1,4-diazepan-1-yl)ethanone;hydrochloride.
| Compound Name | 2-cyclopentyl-1-(1,4-diazepan-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 50988752 |
| Molecular Formula | C12H23ClN2O |
| Molecular Weight | 246.78 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-cyclopentyl-1-(1,4-diazepan-1-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(CC1CCCC1)N1CCCNCC1 |
| InChI | InChI=1S/C12H22N2O.ClH/c15-12(10-11-4-1-2-5-11)14-8-3-6-13-7-9-14;/h11,13H,1-10H2;1H |
| InChIKey | WPIYMJLNJXFXNJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |