C28H35N3O8 — CID 6221200
ethyl 4-[(E)-[2-(2,5-dimethoxyphenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 6221200) has the molecular formula C28H35N3O8 and a molecular weight of 541.60 g/mol. Its IUPAC name is ethyl 4-[(E)-[2-(2,5-dimethoxyphenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[(E)-[2-(2,5-dimethoxyphenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 6221200 |
| Molecular Formula | C28H35N3O8 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | ethyl 4-[(E)-[2-(2,5-dimethoxyphenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(/C(O)=C2\C(=O)C(=O)N(CCN3CCOCC3)C2c2cc(OC)ccc2OC)c1C |
| InChI | InChI=1S/C28H35N3O8/c1-6-39-28(35)23-16(2)21(17(3)29-23)25(32)22-24(19-15-18(36-4)7-8-20(19)37-5)31(27(34)26(22)33)10-9-30-11-13-38-14-12-30/h7-8,15,24,29,32H,6,9-14H2,1-5H3/b25-22+ |
| InChIKey | IXEWQZSVMYHVDJ-YYDJUVGSSA-N |
| XLogP | 2.58 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|