C27H33N3O8 — CID 98314577
methyl 4-[(E)-[(2R)-2-(2,5-dimethoxyphenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 98314577) has the molecular formula C27H33N3O8 and a molecular weight of 527.57 g/mol. Its IUPAC name is methyl 4-[(E)-[(2R)-2-(2,5-dimethoxyphenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[(E)-[(2R)-2-(2,5-dimethoxyphenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 98314577 |
| Molecular Formula | C27H33N3O8 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | methyl 4-[(E)-[(2R)-2-(2,5-dimethoxyphenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c(C)c(/C(O)=C2\C(=O)C(=O)N(CCN3CCOCC3)[C@@H]2c2cc(OC)ccc2OC)c1C |
| InChI | InChI=1S/C27H33N3O8/c1-15-20(16(2)28-22(15)27(34)37-5)24(31)21-23(18-14-17(35-3)6-7-19(18)36-4)30(26(33)25(21)32)9-8-29-10-12-38-13-11-29/h6-7,14,23,28,31H,8-13H2,1-5H3/b24-21+/t23-/m1/s1 |
| InChIKey | BSNCVOJKEWBKBG-COUQNMRISA-N |
| XLogP | 2.19 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|