C12H13Cl2NO4S — CID 62212788
3-chloro-4-(oxane-2-carbonylamino)benzenesulfonyl chloride (PubChem CID 62212788) has the molecular formula C12H13Cl2NO4S and a molecular weight of 338.21 g/mol. Its IUPAC name is 3-chloro-4-(oxane-2-carbonylamino)benzenesulfonyl chloride.
| Compound Name | 3-chloro-4-(oxane-2-carbonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 62212788 |
| Molecular Formula | C12H13Cl2NO4S |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 3-chloro-4-(oxane-2-carbonylamino)benzenesulfonyl chloride |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Cl)cc1Cl)C1CCCCO1 |
| InChI | InChI=1S/C12H13Cl2NO4S/c13-9-7-8(20(14,17)18)4-5-10(9)15-12(16)11-3-1-2-6-19-11/h4-5,7,11H,1-3,6H2,(H,15,16) |
| InChIKey | KSZXTVCPBDCRBI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |