C12H16O3 — CID 62214951
(2,5-dimethylfuran-3-yl)-(oxan-2-yl)methanone (PubChem CID 62214951) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2,5-dimethylfuran-3-yl)-(oxan-2-yl)methanone.
| Compound Name | (2,5-dimethylfuran-3-yl)-(oxan-2-yl)methanone |
|---|---|
| PubChem CID | 62214951 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2,5-dimethylfuran-3-yl)-(oxan-2-yl)methanone |
| SMILES | Cc1cc(C(=O)C2CCCCO2)c(C)o1 |
| InChI | InChI=1S/C12H16O3/c1-8-7-10(9(2)15-8)12(13)11-5-3-4-6-14-11/h7,11H,3-6H2,1-2H3 |
| InChIKey | LGQAPLJEDHMPBA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |