C13H21NO3 — CID 172801054
cyclohexanamine;2,5-dimethylfuran-3-carboxylic acid (PubChem CID 172801054) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is cyclohexanamine;2,5-dimethylfuran-3-carboxylic acid.
| Compound Name | cyclohexanamine;2,5-dimethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 172801054 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | cyclohexanamine;2,5-dimethylfuran-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(C)o1.NC1CCCCC1 |
| InChI | InChI=1S/C7H8O3.C6H13N/c1-4-3-6(7(8)9)5(2)10-4;7-6-4-2-1-3-5-6/h3H,1-2H3,(H,8,9);6H,1-5,7H2 |
| InChIKey | QWERMTIKENSTEV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |