C17H21NO3 — CID 62215167
N-[[2-(3-hydroxyprop-1-ynyl)phenyl]methyl]-N-methyloxane-2-carboxamide (PubChem CID 62215167) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[[2-(3-hydroxyprop-1-ynyl)phenyl]methyl]-N-methyloxane-2-carboxamide.
| Compound Name | N-[[2-(3-hydroxyprop-1-ynyl)phenyl]methyl]-N-methyloxane-2-carboxamide |
|---|---|
| PubChem CID | 62215167 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-[[2-(3-hydroxyprop-1-ynyl)phenyl]methyl]-N-methyloxane-2-carboxamide |
| SMILES | CN(Cc1ccccc1C#CCO)C(=O)C1CCCCO1 |
| InChI | InChI=1S/C17H21NO3/c1-18(17(20)16-10-4-5-12-21-16)13-15-8-3-2-7-14(15)9-6-11-19/h2-3,7-8,16,19H,4-5,10-13H2,1H3 |
| InChIKey | ILQPXPUTYARDAU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|