C12H17N3O2 — CID 62216311
3-(1-pyrimidin-2-ylpiperidin-4-yl)propanoic acid (PubChem CID 62216311) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-(1-pyrimidin-2-ylpiperidin-4-yl)propanoic acid.
| Compound Name | 3-(1-pyrimidin-2-ylpiperidin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 62216311 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-(1-pyrimidin-2-ylpiperidin-4-yl)propanoic acid |
| SMILES | O=C(O)CCC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C12H17N3O2/c16-11(17)3-2-10-4-8-15(9-5-10)12-13-6-1-7-14-12/h1,6-7,10H,2-5,8-9H2,(H,16,17) |
| InChIKey | LZIQWGXDMSISIC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |