About Ethamoxytriphetol
Ethamoxytriphetol (PubChem CID 6222) has the molecular formula C27H33NO3
and a molecular weight of 419.60 g/mol. Its IUPAC name is 1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-methoxyphenyl)-1-phenylethanol.
Molecular Properties
| Compound Name | Ethamoxytriphetol |
| PubChem CID | 6222 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-methoxyphenyl)-1-phenylethanol |
| SMILES | CCN(CC)CCOC1=CC=C(C=C1)C(CC2=CC=C(C=C2)OC)(C3=CC=CC=C3)O |
| InChI | InChI=1S/C27H33NO3/c1-4-28(5-2)19-20-31-26-17-13-24(14-18-26)27(29,23-9-7-6-8-10-23)21-22-11-15-25(30-3)16-12-22/h6-18,29H,4-5,19-21H2,1-3H3 |
| InChIKey | KDYQVUUCWUPJGE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | 475 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Ethamoxytriphetol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethamoxytriphetol?
The IUPAC name of Ethamoxytriphetol (CID 6222) is 1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-methoxyphenyl)-1-phenylethanol.
What is the SMILES notation for Ethamoxytriphetol?
The canonical SMILES for Ethamoxytriphetol is CCN(CC)CCOC1=CC=C(C=C1)C(CC2=CC=C(C=C2)OC)(C3=CC=CC=C3)O.
What is the InChIKey of Ethamoxytriphetol?
The InChIKey is KDYQVUUCWUPJGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33NO3/c1-4-28(5-2)19-20-31-26-17-13-24(14-18-26)27(29,23-9-7-6-8-10-23)21-22-11-15-25(30-3)16-12-22/h6-18,29H,4-5,19-21H2,1-3H3.
What are the key properties of Ethamoxytriphetol?
Ethamoxytriphetol has a molecular weight of 419.60 g/mol, XLogP of 5.20, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Ethamoxytriphetol is sourced from PubChem (CID 6222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).