C16H19F2N3 — CID 62220431
2-tert-butyl-5-(2,5-difluorophenyl)-3-prop-2-enylimidazol-4-amine (PubChem CID 62220431) has the molecular formula C16H19F2N3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,5-difluorophenyl)-3-prop-2-enylimidazol-4-amine.
| Compound Name | 2-tert-butyl-5-(2,5-difluorophenyl)-3-prop-2-enylimidazol-4-amine |
|---|---|
| PubChem CID | 62220431 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-tert-butyl-5-(2,5-difluorophenyl)-3-prop-2-enylimidazol-4-amine |
| SMILES | C=CCn1c(C(C)(C)C)nc(-c2cc(F)ccc2F)c1N |
| InChI | InChI=1S/C16H19F2N3/c1-5-8-21-14(19)13(20-15(21)16(2,3)4)11-9-10(17)6-7-12(11)18/h5-7,9H,1,8,19H2,2-4H3 |
| InChIKey | LVURMVOCWCONKC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|