About 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine
2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine (PubChem CID 83090080) has the molecular formula C15H23N5
and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine |
| PubChem CID | 83090080 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine |
| SMILES | C=CCn1c(C(C)(C)C)nc(-c2cn(C)nc2C)c1N |
| InChI | InChI=1S/C15H23N5/c1-7-8-20-13(16)12(17-14(20)15(3,4)5)11-9-19(6)18-10(11)2/h7,9H,1,8,16H2,2-6H3 |
| InChIKey | GPRZVIFAQYEXAD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine?
The IUPAC name of 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine (CID 83090080) is 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine.
What is the SMILES notation for 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine?
The canonical SMILES for 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine is C=CCn1c(C(C)(C)C)nc(-c2cn(C)nc2C)c1N.
What is the InChIKey of 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine?
The InChIKey is GPRZVIFAQYEXAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N5/c1-7-8-20-13(16)12(17-14(20)15(3,4)5)11-9-19(6)18-10(11)2/h7,9H,1,8,16H2,2-6H3.
What are the key properties of 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine?
2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine has a molecular weight of 273.38 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(1,3-dimethylpyrazol-4-yl)-3-prop-2-enylimidazol-4-amine is sourced from PubChem (CID 83090080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).