C15H29N3O — CID 62222724
2-methyl-N-[[1-[2-(3-methylbutoxy)ethyl]imidazol-2-yl]methyl]propan-2-amine (PubChem CID 62222724) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-methyl-N-[[1-[2-(3-methylbutoxy)ethyl]imidazol-2-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[1-[2-(3-methylbutoxy)ethyl]imidazol-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62222724 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 2-methyl-N-[[1-[2-(3-methylbutoxy)ethyl]imidazol-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)CCOCCn1ccnc1CNC(C)(C)C |
| InChI | InChI=1S/C15H29N3O/c1-13(2)6-10-19-11-9-18-8-7-16-14(18)12-17-15(3,4)5/h7-8,13,17H,6,9-12H2,1-5H3 |
| InChIKey | KTIVASKERVGQHT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|