C13H25N3O2S — CID 65097886
N-[[1-(3-ethylsulfonylpropyl)imidazol-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 65097886) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[[1-(3-ethylsulfonylpropyl)imidazol-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-(3-ethylsulfonylpropyl)imidazol-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 65097886 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[[1-(3-ethylsulfonylpropyl)imidazol-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCS(=O)(=O)CCCn1ccnc1CNC(C)(C)C |
| InChI | InChI=1S/C13H25N3O2S/c1-5-19(17,18)10-6-8-16-9-7-14-12(16)11-15-13(2,3)4/h7,9,15H,5-6,8,10-11H2,1-4H3 |
| InChIKey | GRHGZWLADFIRLH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |