C13H24N4O — CID 62325908
3-[2-[(tert-butylamino)methyl]imidazol-1-yl]-N-ethylpropanamide (PubChem CID 62325908) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-[2-[(tert-butylamino)methyl]imidazol-1-yl]-N-ethylpropanamide.
| Compound Name | 3-[2-[(tert-butylamino)methyl]imidazol-1-yl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 62325908 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 3-[2-[(tert-butylamino)methyl]imidazol-1-yl]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCn1ccnc1CNC(C)(C)C |
| InChI | InChI=1S/C13H24N4O/c1-5-14-12(18)6-8-17-9-7-15-11(17)10-16-13(2,3)4/h7,9,16H,5-6,8,10H2,1-4H3,(H,14,18) |
| InChIKey | FXDBLJJEHYCDEJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |