About 4-hydroxy-2,3-dihydrochromene-4-carboxamide
4-hydroxy-2,3-dihydrochromene-4-carboxamide (PubChem CID 62224010) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 4-hydroxy-2,3-dihydrochromene-4-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-2,3-dihydrochromene-4-carboxamide |
| PubChem CID | 62224010 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-hydroxy-2,3-dihydrochromene-4-carboxamide |
| SMILES | NC(=O)C1(O)CCOc2ccccc21 |
| InChI | InChI=1S/C10H11NO3/c11-9(12)10(13)5-6-14-8-4-2-1-3-7(8)10/h1-4,13H,5-6H2,(H2,11,12) |
| InChIKey | XBAFJETZAUTJQE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-2,3-dihydrochromene-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-dihydrochromene-4-carboxamide?
The IUPAC name of 4-hydroxy-2,3-dihydrochromene-4-carboxamide (CID 62224010) is 4-hydroxy-2,3-dihydrochromene-4-carboxamide.
What is the SMILES notation for 4-hydroxy-2,3-dihydrochromene-4-carboxamide?
The canonical SMILES for 4-hydroxy-2,3-dihydrochromene-4-carboxamide is NC(=O)C1(O)CCOc2ccccc21.
What is the InChIKey of 4-hydroxy-2,3-dihydrochromene-4-carboxamide?
The InChIKey is XBAFJETZAUTJQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c11-9(12)10(13)5-6-14-8-4-2-1-3-7(8)10/h1-4,13H,5-6H2,(H2,11,12).
What are the key properties of 4-hydroxy-2,3-dihydrochromene-4-carboxamide?
4-hydroxy-2,3-dihydrochromene-4-carboxamide has a molecular weight of 193.20 g/mol, XLogP of 0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dihydrochromene-4-carboxamide is sourced from PubChem (CID 62224010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).