C10H11NO3 — CID 62224010
4-hydroxy-2,3-dihydrochromene-4-carboxamide (PubChem CID 62224010) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 4-hydroxy-2,3-dihydrochromene-4-carboxamide.
| Compound Name | 4-hydroxy-2,3-dihydrochromene-4-carboxamide |
|---|---|
| PubChem CID | 62224010 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-hydroxy-2,3-dihydrochromene-4-carboxamide |
| SMILES | NC(=O)C1(O)CCOc2ccccc21 |
| InChI | InChI=1S/C10H11NO3/c11-9(12)10(13)5-6-14-8-4-2-1-3-7(8)10/h1-4,13H,5-6H2,(H2,11,12) |
| InChIKey | XBAFJETZAUTJQE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |