C14H14F3N3O — CID 62224490
3-cyclopropyl-2-methyl-5-[2-(trifluoromethoxy)phenyl]imidazol-4-amine (PubChem CID 62224490) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 3-cyclopropyl-2-methyl-5-[2-(trifluoromethoxy)phenyl]imidazol-4-amine.
| Compound Name | 3-cyclopropyl-2-methyl-5-[2-(trifluoromethoxy)phenyl]imidazol-4-amine |
|---|---|
| PubChem CID | 62224490 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-cyclopropyl-2-methyl-5-[2-(trifluoromethoxy)phenyl]imidazol-4-amine |
| SMILES | Cc1nc(-c2ccccc2OC(F)(F)F)c(N)n1C1CC1 |
| InChI | InChI=1S/C14H14F3N3O/c1-8-19-12(13(18)20(8)9-6-7-9)10-4-2-3-5-11(10)21-14(15,16)17/h2-5,9H,6-7,18H2,1H3 |
| InChIKey | ONOIQBAPWWBTKI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |