C13H23N3 — CID 62226573
5-cyclohexyl-2,3-diethylimidazol-4-amine (PubChem CID 62226573) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 5-cyclohexyl-2,3-diethylimidazol-4-amine.
| Compound Name | 5-cyclohexyl-2,3-diethylimidazol-4-amine |
|---|---|
| PubChem CID | 62226573 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 5-cyclohexyl-2,3-diethylimidazol-4-amine |
| SMILES | CCc1nc(C2CCCCC2)c(N)n1CC |
| InChI | InChI=1S/C13H23N3/c1-3-11-15-12(13(14)16(11)4-2)10-8-6-5-7-9-10/h10H,3-9,14H2,1-2H3 |
| InChIKey | YRAOLEDXZLRMSY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |