C15H14ClNO — CID 62240738
2-(chloromethyl)-6-(2,3-dihydro-1H-inden-5-yloxy)pyridine (PubChem CID 62240738) has the molecular formula C15H14ClNO and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-(chloromethyl)-6-(2,3-dihydro-1H-inden-5-yloxy)pyridine.
| Compound Name | 2-(chloromethyl)-6-(2,3-dihydro-1H-inden-5-yloxy)pyridine |
|---|---|
| PubChem CID | 62240738 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-(chloromethyl)-6-(2,3-dihydro-1H-inden-5-yloxy)pyridine |
| SMILES | ClCc1cccc(Oc2ccc3c(c2)CCC3)n1 |
| InChI | InChI=1S/C15H14ClNO/c16-10-13-5-2-6-15(17-13)18-14-8-7-11-3-1-4-12(11)9-14/h2,5-9H,1,3-4,10H2 |
| InChIKey | CSXNEPZTXABAOD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|