C15H14ClNO — CID 79241095
2-chloro-6-(2,3-dihydro-1H-inden-5-yloxymethyl)pyridine (PubChem CID 79241095) has the molecular formula C15H14ClNO and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-chloro-6-(2,3-dihydro-1H-inden-5-yloxymethyl)pyridine.
| Compound Name | 2-chloro-6-(2,3-dihydro-1H-inden-5-yloxymethyl)pyridine |
|---|---|
| PubChem CID | 79241095 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-chloro-6-(2,3-dihydro-1H-inden-5-yloxymethyl)pyridine |
| SMILES | Clc1cccc(COc2ccc3c(c2)CCC3)n1 |
| InChI | InChI=1S/C15H14ClNO/c16-15-6-2-5-13(17-15)10-18-14-8-7-11-3-1-4-12(11)9-14/h2,5-9H,1,3-4,10H2 |
| InChIKey | OEHHJYHPZVIDCU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|