C14H14Cl2N4O — CID 62241888
3-chloro-N-[(2-chlorophenyl)methyl]-6-hydrazinyl-N-methylpyridine-2-carboxamide (PubChem CID 62241888) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is 3-chloro-N-[(2-chlorophenyl)methyl]-6-hydrazinyl-N-methylpyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[(2-chlorophenyl)methyl]-6-hydrazinyl-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62241888 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-chloro-N-[(2-chlorophenyl)methyl]-6-hydrazinyl-N-methylpyridine-2-carboxamide |
| SMILES | CN(Cc1ccccc1Cl)C(=O)c1nc(NN)ccc1Cl |
| InChI | InChI=1S/C14H14Cl2N4O/c1-20(8-9-4-2-3-5-10(9)15)14(21)13-11(16)6-7-12(18-13)19-17/h2-7H,8,17H2,1H3,(H,18,19) |
| InChIKey | DQEQIBHVSHCRJG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|