C13H18N4O4 — CID 62242699
(2,5-dimethylmorpholin-4-yl)-(5-hydrazinyl-2-nitrophenyl)methanone (PubChem CID 62242699) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2,5-dimethylmorpholin-4-yl)-(5-hydrazinyl-2-nitrophenyl)methanone.
| Compound Name | (2,5-dimethylmorpholin-4-yl)-(5-hydrazinyl-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 62242699 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2,5-dimethylmorpholin-4-yl)-(5-hydrazinyl-2-nitrophenyl)methanone |
| SMILES | CC1CN(C(=O)c2cc(NN)ccc2[N+](=O)[O-])C(C)CO1 |
| InChI | InChI=1S/C13H18N4O4/c1-8-7-21-9(2)6-16(8)13(18)11-5-10(15-14)3-4-12(11)17(19)20/h3-5,8-9,15H,6-7,14H2,1-2H3 |
| InChIKey | XIOYKDBHDXGFLY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|