C14H23N5O2 — CID 62243246
(2-ethylmorpholin-4-yl)-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone (PubChem CID 62243246) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2-ethylmorpholin-4-yl)-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone.
| Compound Name | (2-ethylmorpholin-4-yl)-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 62243246 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (2-ethylmorpholin-4-yl)-(5-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)methanone |
| SMILES | CCC1CN(C(=O)c2nc(C(C)C)ncc2NN)CCO1 |
| InChI | InChI=1S/C14H23N5O2/c1-4-10-8-19(5-6-21-10)14(20)12-11(18-15)7-16-13(17-12)9(2)3/h7,9-10,18H,4-6,8,15H2,1-3H3 |
| InChIKey | WHYYOBRRPONGQL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|