C22H24N2O3S — CID 6224559
(E)-3-[1-(2-hydroxy-3-morpholin-4-ylpropyl)indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one (PubChem CID 6224559) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (E)-3-[1-(2-hydroxy-3-morpholin-4-ylpropyl)indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[1-(2-hydroxy-3-morpholin-4-ylpropyl)indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 6224559 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (E)-3-[1-(2-hydroxy-3-morpholin-4-ylpropyl)indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(CC(O)CN2CCOCC2)c2ccccc12)c1cccs1 |
| InChI | InChI=1S/C22H24N2O3S/c25-18(15-23-9-11-27-12-10-23)16-24-14-17(19-4-1-2-5-20(19)24)7-8-21(26)22-6-3-13-28-22/h1-8,13-14,18,25H,9-12,15-16H2/b8-7+ |
| InChIKey | KNSVPMPQEKEHRK-BQYQJAHWSA-N |
| XLogP | 3.29 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|