C13H16N4O2S — CID 62245796
[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]quinolin-2-yl]hydrazine (PubChem CID 62245796) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is [3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]quinolin-2-yl]hydrazine.
| Compound Name | [3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]quinolin-2-yl]hydrazine |
|---|---|
| PubChem CID | 62245796 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]quinolin-2-yl]hydrazine |
| SMILES | NNc1nc2ccccc2cc1CN1CCCS1(=O)=O |
| InChI | InChI=1S/C13H16N4O2S/c14-16-13-11(9-17-6-3-7-20(17,18)19)8-10-4-1-2-5-12(10)15-13/h1-2,4-5,8H,3,6-7,9,14H2,(H,15,16) |
| InChIKey | GZKQMRKGGDBLMA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|