About [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine
[1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine (PubChem CID 62246236) has the molecular formula C11H21N5O
and a molecular weight of 239.32 g/mol. Its IUPAC name is [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine.
Molecular Properties
| Compound Name | [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine |
| PubChem CID | 62246236 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine |
| SMILES | Cc1nn(C)c(NN)c1CN1CCOCC1C |
| InChI | InChI=1S/C11H21N5O/c1-8-7-17-5-4-16(8)6-10-9(2)14-15(3)11(10)13-12/h8,13H,4-7,12H2,1-3H3 |
| InChIKey | HZTHOXDFDZUUQL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine?
The IUPAC name of [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine (CID 62246236) is [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine.
What is the SMILES notation for [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine?
The canonical SMILES for [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine is Cc1nn(C)c(NN)c1CN1CCOCC1C.
What is the InChIKey of [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine?
The InChIKey is HZTHOXDFDZUUQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5O/c1-8-7-17-5-4-16(8)6-10-9(2)14-15(3)11(10)13-12/h8,13H,4-7,12H2,1-3H3.
What are the key properties of [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine?
[1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine has a molecular weight of 239.32 g/mol, XLogP of 0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dimethyl-4-[(3-methylmorpholin-4-yl)methyl]pyrazol-5-yl]hydrazine is sourced from PubChem (CID 62246236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).