C7H14N4O — CID 62245433
[4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine (PubChem CID 62245433) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine.
| Compound Name | [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 62245433 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine |
| SMILES | COCc1c(C)nn(C)c1NN |
| InChI | InChI=1S/C7H14N4O/c1-5-6(4-12-3)7(9-8)11(2)10-5/h9H,4,8H2,1-3H3 |
| InChIKey | KWMRUNUSWIBANC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|