About [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine
[4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine (PubChem CID 62245433) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine.
Molecular Properties
| Compound Name | [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine |
| PubChem CID | 62245433 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine |
| SMILES | COCc1c(C)nn(C)c1NN |
| InChI | InChI=1S/C7H14N4O/c1-5-6(4-12-3)7(9-8)11(2)10-5/h9H,4,8H2,1-3H3 |
| InChIKey | KWMRUNUSWIBANC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine?
The IUPAC name of [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine (CID 62245433) is [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine.
What is the SMILES notation for [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine?
The canonical SMILES for [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine is COCc1c(C)nn(C)c1NN.
What is the InChIKey of [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine?
The InChIKey is KWMRUNUSWIBANC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-5-6(4-12-3)7(9-8)11(2)10-5/h9H,4,8H2,1-3H3.
What are the key properties of [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine?
[4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine has a molecular weight of 170.22 g/mol, XLogP of 0.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methoxymethyl)-1,3-dimethylpyrazol-5-yl]hydrazine is sourced from PubChem (CID 62245433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).