C12H25N5 — CID 62246707
N-[(5-hydrazinyl-1,3-dimethylpyrazol-4-yl)methyl]-N,2-dimethylbutan-1-amine (PubChem CID 62246707) has the molecular formula C12H25N5 and a molecular weight of 239.37 g/mol. Its IUPAC name is N-[(5-hydrazinyl-1,3-dimethylpyrazol-4-yl)methyl]-N,2-dimethylbutan-1-amine.
| Compound Name | N-[(5-hydrazinyl-1,3-dimethylpyrazol-4-yl)methyl]-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 62246707 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | N-[(5-hydrazinyl-1,3-dimethylpyrazol-4-yl)methyl]-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)CN(C)Cc1c(C)nn(C)c1NN |
| InChI | InChI=1S/C12H25N5/c1-6-9(2)7-16(4)8-11-10(3)15-17(5)12(11)14-13/h9,14H,6-8,13H2,1-5H3 |
| InChIKey | DZCFNCXUBCYZDS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|