About N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine
N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine (PubChem CID 79763890) has the molecular formula C10H20N4S
and a molecular weight of 228.36 g/mol. Its IUPAC name is N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine |
| PubChem CID | 79763890 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)CN(C)Cc1cnc(NN)s1 |
| InChI | InChI=1S/C10H20N4S/c1-4-8(2)6-14(3)7-9-5-12-10(13-11)15-9/h5,8H,4,6-7,11H2,1-3H3,(H,12,13) |
| InChIKey | GGIPEOPIVWSWGJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine?
The IUPAC name of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine (CID 79763890) is N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine.
What is the SMILES notation for N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine?
The canonical SMILES for N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine is CCC(C)CN(C)Cc1cnc(NN)s1.
What is the InChIKey of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine?
The InChIKey is GGIPEOPIVWSWGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4S/c1-4-8(2)6-14(3)7-9-5-12-10(13-11)15-9/h5,8H,4,6-7,11H2,1-3H3,(H,12,13).
What are the key properties of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine?
N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine has a molecular weight of 228.36 g/mol, XLogP of 1.91, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 79763890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).