C10H20N4S — CID 62252125
[1,3-dimethyl-4-(2-methylpropylsulfanylmethyl)pyrazol-5-yl]hydrazine (PubChem CID 62252125) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is [1,3-dimethyl-4-(2-methylpropylsulfanylmethyl)pyrazol-5-yl]hydrazine.
| Compound Name | [1,3-dimethyl-4-(2-methylpropylsulfanylmethyl)pyrazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 62252125 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [1,3-dimethyl-4-(2-methylpropylsulfanylmethyl)pyrazol-5-yl]hydrazine |
| SMILES | Cc1nn(C)c(NN)c1CSCC(C)C |
| InChI | InChI=1S/C10H20N4S/c1-7(2)5-15-6-9-8(3)13-14(4)10(9)12-11/h7,12H,5-6,11H2,1-4H3 |
| InChIKey | FAYWMKPXUPTSTN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|