About [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol
[5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol (PubChem CID 138603081) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol.
Analyze [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol?
The IUPAC name of [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol (CID 138603081) is [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol.
What is the SMILES notation for [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol?
The canonical SMILES for [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol is COCc1c(CO)c(C)nn1C.
What is the InChIKey of [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol?
The InChIKey is YKJYLEAAWNNHDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-6-7(4-11)8(5-12-3)10(2)9-6/h11H,4-5H2,1-3H3.
What are the key properties of [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol?
[5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol has a molecular weight of 170.21 g/mol, XLogP of 0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(methoxymethyl)-1,3-dimethylpyrazol-4-yl]methanol is sourced from PubChem (CID 138603081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).