C14H18N2O2 — CID 28964156
[5-(3,5-dimethylphenoxy)-1,3-dimethylpyrazol-4-yl]methanol (PubChem CID 28964156) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is [5-(3,5-dimethylphenoxy)-1,3-dimethylpyrazol-4-yl]methanol.
| Compound Name | [5-(3,5-dimethylphenoxy)-1,3-dimethylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 28964156 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [5-(3,5-dimethylphenoxy)-1,3-dimethylpyrazol-4-yl]methanol |
| SMILES | Cc1cc(C)cc(Oc2c(CO)c(C)nn2C)c1 |
| InChI | InChI=1S/C14H18N2O2/c1-9-5-10(2)7-12(6-9)18-14-13(8-17)11(3)15-16(14)4/h5-7,17H,8H2,1-4H3 |
| InChIKey | RBEZPFBCVDPYQZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |