C12H11Cl2N3O4 — CID 107500283
[5-(4,5-dichloro-2-nitrophenoxy)-1,3-dimethylpyrazol-4-yl]methanol (PubChem CID 107500283) has the molecular formula C12H11Cl2N3O4 and a molecular weight of 332.14 g/mol. Its IUPAC name is [5-(4,5-dichloro-2-nitrophenoxy)-1,3-dimethylpyrazol-4-yl]methanol.
| Compound Name | [5-(4,5-dichloro-2-nitrophenoxy)-1,3-dimethylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 107500283 |
| Molecular Formula | C12H11Cl2N3O4 |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | [5-(4,5-dichloro-2-nitrophenoxy)-1,3-dimethylpyrazol-4-yl]methanol |
| SMILES | Cc1nn(C)c(Oc2cc(Cl)c(Cl)cc2[N+](=O)[O-])c1CO |
| InChI | InChI=1S/C12H11Cl2N3O4/c1-6-7(5-18)12(16(2)15-6)21-11-4-9(14)8(13)3-10(11)17(19)20/h3-4,18H,5H2,1-2H3 |
| InChIKey | HKVAHHOQGWRHSY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|