C12H10Cl3N3O3 — CID 107500426
4-(chloromethyl)-5-(4,5-dichloro-2-nitrophenoxy)-1,3-dimethylpyrazole (PubChem CID 107500426) has the molecular formula C12H10Cl3N3O3 and a molecular weight of 350.59 g/mol. Its IUPAC name is 4-(chloromethyl)-5-(4,5-dichloro-2-nitrophenoxy)-1,3-dimethylpyrazole.
| Compound Name | 4-(chloromethyl)-5-(4,5-dichloro-2-nitrophenoxy)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 107500426 |
| Molecular Formula | C12H10Cl3N3O3 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 4-(chloromethyl)-5-(4,5-dichloro-2-nitrophenoxy)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(Oc2cc(Cl)c(Cl)cc2[N+](=O)[O-])c1CCl |
| InChI | InChI=1S/C12H10Cl3N3O3/c1-6-7(5-13)12(17(2)16-6)21-11-4-9(15)8(14)3-10(11)18(19)20/h3-4H,5H2,1-2H3 |
| InChIKey | JVRROFBZAQZRNQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|