C12H10Cl4N2O — CID 28964659
4-(chloromethyl)-1,3-dimethyl-5-(2,4,5-trichlorophenoxy)pyrazole (PubChem CID 28964659) has the molecular formula C12H10Cl4N2O and a molecular weight of 340.04 g/mol. Its IUPAC name is 4-(chloromethyl)-1,3-dimethyl-5-(2,4,5-trichlorophenoxy)pyrazole.
| Compound Name | 4-(chloromethyl)-1,3-dimethyl-5-(2,4,5-trichlorophenoxy)pyrazole |
|---|---|
| PubChem CID | 28964659 |
| Molecular Formula | C12H10Cl4N2O |
| Molecular Weight | 340.04 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | 4-(chloromethyl)-1,3-dimethyl-5-(2,4,5-trichlorophenoxy)pyrazole |
| SMILES | Cc1nn(C)c(Oc2cc(Cl)c(Cl)cc2Cl)c1CCl |
| InChI | InChI=1S/C12H10Cl4N2O/c1-6-7(5-13)12(18(2)17-6)19-11-4-9(15)8(14)3-10(11)16/h3-4H,5H2,1-2H3 |
| InChIKey | VTDNHCINUWECHY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.04 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|