C12H11Cl3N2O — CID 28964844
4-(chloromethyl)-5-(2,4-dichlorophenoxy)-1,3-dimethylpyrazole (PubChem CID 28964844) has the molecular formula C12H11Cl3N2O and a molecular weight of 305.59 g/mol. Its IUPAC name is 4-(chloromethyl)-5-(2,4-dichlorophenoxy)-1,3-dimethylpyrazole.
| Compound Name | 4-(chloromethyl)-5-(2,4-dichlorophenoxy)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 28964844 |
| Molecular Formula | C12H11Cl3N2O |
| Molecular Weight | 305.59 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 4-(chloromethyl)-5-(2,4-dichlorophenoxy)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(Oc2ccc(Cl)cc2Cl)c1CCl |
| InChI | InChI=1S/C12H11Cl3N2O/c1-7-9(6-13)12(17(2)16-7)18-11-4-3-8(14)5-10(11)15/h3-5H,6H2,1-2H3 |
| InChIKey | OZHKOZPCHWBIRQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|