C15H19ClN2O2 — CID 28971291
4-(chloromethyl)-1,3-dimethyl-5-(4-propoxyphenoxy)pyrazole (PubChem CID 28971291) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 4-(chloromethyl)-1,3-dimethyl-5-(4-propoxyphenoxy)pyrazole.
| Compound Name | 4-(chloromethyl)-1,3-dimethyl-5-(4-propoxyphenoxy)pyrazole |
|---|---|
| PubChem CID | 28971291 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 4-(chloromethyl)-1,3-dimethyl-5-(4-propoxyphenoxy)pyrazole |
| SMILES | CCCOc1ccc(Oc2c(CCl)c(C)nn2C)cc1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-4-9-19-12-5-7-13(8-6-12)20-15-14(10-16)11(2)17-18(15)3/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | PUXNSHXNKRMSRU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|