C13H15ClN2O — CID 28964580
4-(chloromethyl)-1,3-dimethyl-5-phenylmethoxypyrazole (PubChem CID 28964580) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 4-(chloromethyl)-1,3-dimethyl-5-phenylmethoxypyrazole.
| Compound Name | 4-(chloromethyl)-1,3-dimethyl-5-phenylmethoxypyrazole |
|---|---|
| PubChem CID | 28964580 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-(chloromethyl)-1,3-dimethyl-5-phenylmethoxypyrazole |
| SMILES | Cc1nn(C)c(OCc2ccccc2)c1CCl |
| InChI | InChI=1S/C13H15ClN2O/c1-10-12(8-14)13(16(2)15-10)17-9-11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3 |
| InChIKey | COTJIIWDAGWFCO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|