C14H18N2O3 — CID 28964073
[5-(4-ethoxyphenoxy)-1,3-dimethylpyrazol-4-yl]methanol (PubChem CID 28964073) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is [5-(4-ethoxyphenoxy)-1,3-dimethylpyrazol-4-yl]methanol.
| Compound Name | [5-(4-ethoxyphenoxy)-1,3-dimethylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 28964073 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | [5-(4-ethoxyphenoxy)-1,3-dimethylpyrazol-4-yl]methanol |
| SMILES | CCOc1ccc(Oc2c(CO)c(C)nn2C)cc1 |
| InChI | InChI=1S/C14H18N2O3/c1-4-18-11-5-7-12(8-6-11)19-14-13(9-17)10(2)15-16(14)3/h5-8,17H,4,9H2,1-3H3 |
| InChIKey | RWKWBZBRAUYBRR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |