About 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol
2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol (PubChem CID 68710129) has the molecular formula C16H20Cl2N2O2
and a molecular weight of 343.25 g/mol. Its IUPAC name is 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol.
Molecular Properties
| Compound Name | 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol |
| PubChem CID | 68710129 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol |
| SMILES | CCCCCc1c(C)nn(C)c1Oc1cc(O)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-4-5-6-7-11-10(2)19-20(3)16(11)22-15-9-14(21)12(17)8-13(15)18/h8-9,21H,4-7H2,1-3H3 |
| InChIKey | NCJWFOABJQMGDR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol?
The IUPAC name of 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol (CID 68710129) is 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol.
What is the SMILES notation for 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol?
The canonical SMILES for 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol is CCCCCc1c(C)nn(C)c1Oc1cc(O)c(Cl)cc1Cl.
What is the InChIKey of 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol?
The InChIKey is NCJWFOABJQMGDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O2/c1-4-5-6-7-11-10(2)19-20(3)16(11)22-15-9-14(21)12(17)8-13(15)18/h8-9,21H,4-7H2,1-3H3.
What are the key properties of 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol?
2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol has a molecular weight of 343.25 g/mol, XLogP of 5.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-(1,3-dimethyl-4-pentylpyrazol-5-yl)oxyphenol is sourced from PubChem (CID 68710129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).