C10H16N4O2S — CID 62246996
[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-pyridinyl]hydrazine (PubChem CID 62246996) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is [5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-pyridinyl]hydrazine.
| Compound Name | [5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62246996 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | [5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(CN2CCS(=O)(=O)CC2)cn1 |
| InChI | InChI=1S/C10H16N4O2S/c11-13-10-2-1-9(7-12-10)8-14-3-5-17(15,16)6-4-14/h1-2,7H,3-6,8,11H2,(H,12,13) |
| InChIKey | LAXLLVPVXUCHPH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|