C10H13IN2O2S — CID 134406111
4-[(6-iodo-3-pyridinyl)methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 134406111) has the molecular formula C10H13IN2O2S and a molecular weight of 352.20 g/mol. Its IUPAC name is 4-[(6-iodo-3-pyridinyl)methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(6-iodo-3-pyridinyl)methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 134406111 |
| Molecular Formula | C10H13IN2O2S |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 4-[(6-iodo-3-pyridinyl)methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(Cc2ccc(I)nc2)CC1 |
| InChI | InChI=1S/C10H13IN2O2S/c11-10-2-1-9(7-12-10)8-13-3-5-16(14,15)6-4-13/h1-2,7H,3-6,8H2 |
| InChIKey | HEIOAZASTUPVMT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|