C12H20N6O — CID 62249790
6-hydrazinyl-N-(2-piperidin-1-ylethyl)pyridazine-3-carboxamide (PubChem CID 62249790) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-piperidin-1-ylethyl)pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-(2-piperidin-1-ylethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62249790 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 6-hydrazinyl-N-(2-piperidin-1-ylethyl)pyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)NCCN2CCCCC2)nn1 |
| InChI | InChI=1S/C12H20N6O/c13-15-11-5-4-10(16-17-11)12(19)14-6-9-18-7-2-1-3-8-18/h4-5H,1-3,6-9,13H2,(H,14,19)(H,15,17) |
| InChIKey | LOLBFAXRXVANNQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|