C24H32N6O2 — CID 155469549
3-N-(2-aminophenyl)-6-N-[2-(3-azaspiro[5.5]undecan-3-yl)ethyl]pyridazine-3,6-dicarboxamide (PubChem CID 155469549) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-N-(2-aminophenyl)-6-N-[2-(3-azaspiro[5.5]undecan-3-yl)ethyl]pyridazine-3,6-dicarboxamide.
| Compound Name | 3-N-(2-aminophenyl)-6-N-[2-(3-azaspiro[5.5]undecan-3-yl)ethyl]pyridazine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 155469549 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 3-N-(2-aminophenyl)-6-N-[2-(3-azaspiro[5.5]undecan-3-yl)ethyl]pyridazine-3,6-dicarboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C(=O)NCCN2CCC3(CCCCC3)CC2)nn1 |
| InChI | InChI=1S/C24H32N6O2/c25-18-6-2-3-7-19(18)27-23(32)21-9-8-20(28-29-21)22(31)26-14-17-30-15-12-24(13-16-30)10-4-1-5-11-24/h2-3,6-9H,1,4-5,10-17,25H2,(H,26,31)(H,27,32) |
| InChIKey | GZDUTALSOOCNTI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|