C8H6Br2N4O — CID 62251486
[2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine (PubChem CID 62251486) has the molecular formula C8H6Br2N4O and a molecular weight of 333.97 g/mol. Its IUPAC name is [2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62251486 |
| Molecular Formula | C8H6Br2N4O |
| Molecular Weight | 333.97 g/mol |
| Exact Mass | 331.89 |
| IUPAC Name | [2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1ccnc(-c2cc(Br)c(Br)o2)n1 |
| InChI | InChI=1S/C8H6Br2N4O/c9-4-3-5(15-7(4)10)8-12-2-1-6(13-8)14-11/h1-3H,11H2,(H,12,13,14) |
| InChIKey | WOZUUGKBSUKEJS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.97 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|