C12H16N4S — CID 62251669
[2-(3-methylthiophen-2-yl)-6-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 62251669) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is [2-(3-methylthiophen-2-yl)-6-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-(3-methylthiophen-2-yl)-6-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62251669 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | [2-(3-methylthiophen-2-yl)-6-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1ccsc1-c1nc(NN)cc(C(C)C)n1 |
| InChI | InChI=1S/C12H16N4S/c1-7(2)9-6-10(16-13)15-12(14-9)11-8(3)4-5-17-11/h4-7H,13H2,1-3H3,(H,14,15,16) |
| InChIKey | XJVUXZBCNVBOKC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|